![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[DIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | [Linda_Martín_Alcoff]_Visible_Identities_Race,_G(BookZZ_org).pdf | 02-May-2016 09:39 | 1.7M | |
| [Kwame_Anthony_Appiah,_Amy_Gutmann,_David_B__Wilki(BookZZ_org).pdf | 03-Feb-2016 12:51 | 667K | |
| Winter, Race and Biology.pdf | 03-Feb-2016 12:51 | 647K | |
| Spencer, Quayshawn_ Philosophy of race meets population genetics.pdf | 03-Feb-2016 12:51 | 404K | |
| Sesion 15_ HaslangerSocialConstAnalysisOfRace-chapter-10.pdf | 15-Feb-2016 20:13 | 218K | |
| Sesion 14_ Ron Mallon_ ‘Race’, Normative, Not Metaphysical or Semantic.pdf | 15-Feb-2016 23:15 | 228K | |
| Sesion 11_ Root, How to divide the world.pdf | 17-Feb-2016 10:01 | 228K | |
| Sesion 11_ DuBoisTHE CONSERVATION OF RACESs.pdf | 15-Feb-2016 20:13 | 166K | |
| Sesion 10_ Ludwig_ Against the new metaphysics of race.pdf | 17-Feb-2016 10:01 | 522K | |
| Sesion 8_ Massimo Pigliucci and Jonathan Kaplan, On the Concept of Biological Race and Its Applicability to Humans.pdf | 15-Feb-2016 23:15 | 176K | |
| Sesion 8_ Kaplan y Winter, Realism, antirealism and conventionalism about race.pdf | 17-Feb-2016 10:01 | 134K | |
| Sesion 6_ Spencer, A radical solution to the race problem.pdf | 15-Feb-2016 13:08 | 1.2M | |
| Sesion 5_ AndreasenNewPerspective.pdf | 15-Feb-2016 13:05 | 2.7M | |
| Sesion 4_ [Joshua_Glasgow]_A_Theory_of_Race.pdf | 15-Feb-2016 13:04 | 1.0M | |
| Sesión 13_ Haslanger, Sally_ Social structure, narrative and explanation.pdf | 21-Apr-2016 13:46 | 138K | |
| Sesardic, Race a social destruction of a biological concept.pdf | 03-Feb-2016 12:51 | 300K | |
| Science Is Not Always 'Self-Correcting' (N_ Cofnas).pdf | 03-Feb-2016 12:51 | 244K | |
| SHELBY_ Integration.pdf | 21-Apr-2016 13:46 | 125K | |
| Race etnicity and joining the club.pdf | 29-Jan-2016 18:08 | 318K | |
| Para una critica de la nocion de raza Lopez Beltran.pdf | 29-Jan-2016 18:08 | 288K | |
| Navarrete, México sin mestizaje.pdf | 12-May-2016 17:12 | 143K | |
| J Hered-1941-ASHLEY MONTAGU-243-8.pdf | 03-Feb-2016 13:00 | 1.0M | |
| Hochman_ Against the new racial naturalism.pdf | 03-Feb-2016 12:51 | 1.0M | |
| Glasgow, A third way in the race debate.pdf | 03-Feb-2016 13:13 | 117K | |
| 4statementsRACE.pdf | 03-Feb-2016 12:51 | 2.9M | |
| 2_ Zack_ Philosophy and racial paridigms.pdf | 03-Feb-2016 12:51 | 56K | |
| 2_ Appia, how to decide if races exist.pdf | 03-Feb-2016 12:51 | 106K | |
|
|---|